About 1H-quinolin-4-one;trihydrate
1H-quinolin-4-one;trihydrate (PubChem CID 22766098) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is 1H-quinolin-4-one;trihydrate.
Molecular Properties
| Compound Name | 1H-quinolin-4-one;trihydrate |
| PubChem CID | 22766098 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1H-quinolin-4-one;trihydrate |
| SMILES | O.O.O.O=c1cc[nH]c2ccccc12 |
| InChI | InChI=1S/C9H7NO.3H2O/c11-9-5-6-10-8-4-2-1-3-7(8)9;;;/h1-6H,(H,10,11);3*1H2 |
| InChIKey | CRCWPUKBRRQLQP-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-quinolin-4-one;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-quinolin-4-one;trihydrate?
The IUPAC name of 1H-quinolin-4-one;trihydrate (CID 22766098) is 1H-quinolin-4-one;trihydrate.
What is the SMILES notation for 1H-quinolin-4-one;trihydrate?
The canonical SMILES for 1H-quinolin-4-one;trihydrate is O.O.O.O=c1cc[nH]c2ccccc12.
What is the InChIKey of 1H-quinolin-4-one;trihydrate?
The InChIKey is CRCWPUKBRRQLQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.3H2O/c11-9-5-6-10-8-4-2-1-3-7(8)9;;;/h1-6H,(H,10,11);3*1H2.
What are the key properties of 1H-quinolin-4-one;trihydrate?
1H-quinolin-4-one;trihydrate has a molecular weight of 199.21 g/mol, XLogP of -0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-quinolin-4-one;trihydrate is sourced from PubChem (CID 22766098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).