About N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine
N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine (PubChem CID 22766277) has the molecular formula C11H23NO4
and a molecular weight of 233.31 g/mol. Its IUPAC name is N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine.
Molecular Properties
| Compound Name | N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine |
| PubChem CID | 22766277 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine |
| SMILES | CCOC(CCNCC1OCCO1)OCC |
| InChI | InChI=1S/C11H23NO4/c1-3-13-10(14-4-2)5-6-12-9-11-15-7-8-16-11/h10-12H,3-9H2,1-2H3 |
| InChIKey | PTSWUFGWQPENTR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine?
The IUPAC name of N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine (CID 22766277) is N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine.
What is the SMILES notation for N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine?
The canonical SMILES for N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine is CCOC(CCNCC1OCCO1)OCC.
What is the InChIKey of N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine?
The InChIKey is PTSWUFGWQPENTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO4/c1-3-13-10(14-4-2)5-6-12-9-11-15-7-8-16-11/h10-12H,3-9H2,1-2H3.
What are the key properties of N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine?
N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine has a molecular weight of 233.31 g/mol, XLogP of 0.74, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dioxolan-2-ylmethyl)-3,3-diethoxypropan-1-amine is sourced from PubChem (CID 22766277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).