About 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine
2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine (PubChem CID 22766671) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine |
| PubChem CID | 22766671 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine |
| SMILES | CCC/C=C(\CC)C1NCCO1 |
| InChI | InChI=1S/C10H19NO/c1-3-5-6-9(4-2)10-11-7-8-12-10/h6,10-11H,3-5,7-8H2,1-2H3/b9-6+ |
| InChIKey | FXNDVVQSJZBJFG-RMKNXTFCSA-N |
| XLogP | 2.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine?
The IUPAC name of 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine (CID 22766671) is 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine.
What is the SMILES notation for 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine?
The canonical SMILES for 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine is CCC/C=C(\CC)C1NCCO1.
What is the InChIKey of 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine?
The InChIKey is FXNDVVQSJZBJFG-RMKNXTFCSA-N. The full InChI is InChI=1S/C10H19NO/c1-3-5-6-9(4-2)10-11-7-8-12-10/h6,10-11H,3-5,7-8H2,1-2H3/b9-6+.
What are the key properties of 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine?
2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine has a molecular weight of 169.27 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-hept-3-en-3-yl]-1,3-oxazolidine is sourced from PubChem (CID 22766671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).