About phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol
phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol (PubChem CID 22767105) has the molecular formula C19H13Cl3O2
and a molecular weight of 379.67 g/mol. Its IUPAC name is phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol.
Molecular Properties
| Compound Name | phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol |
| PubChem CID | 22767105 |
| Molecular Formula | C19H13Cl3O2 |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol |
| SMILES | OC(c1ccccc1)c1ccc(Oc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H13Cl3O2/c20-14-10-16(21)19(17(22)11-14)24-15-8-6-13(7-9-15)18(23)12-4-2-1-3-5-12/h1-11,18,23H |
| InChIKey | VTPVVIVOLHUXDV-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol?
The IUPAC name of phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol (CID 22767105) is phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol.
What is the SMILES notation for phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol?
The canonical SMILES for phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol is OC(c1ccccc1)c1ccc(Oc2c(Cl)cc(Cl)cc2Cl)cc1.
What is the InChIKey of phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol?
The InChIKey is VTPVVIVOLHUXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl3O2/c20-14-10-16(21)19(17(22)11-14)24-15-8-6-13(7-9-15)18(23)12-4-2-1-3-5-12/h1-11,18,23H.
What are the key properties of phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol?
phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol has a molecular weight of 379.67 g/mol, XLogP of 6.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-[4-(2,4,6-trichlorophenoxy)phenyl]methanol is sourced from PubChem (CID 22767105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).