C19H20ClNO — CID 22767464
5-(2-chlorophenyl)-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-7-ol (PubChem CID 22767464) has the molecular formula C19H20ClNO and a molecular weight of 313.83 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-7-ol.
| Compound Name | 5-(2-chlorophenyl)-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-7-ol |
|---|---|
| PubChem CID | 22767464 |
| Molecular Formula | C19H20ClNO |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 5-(2-chlorophenyl)-1-methyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridin-7-ol |
| SMILES | CN1CCCC2C(c3ccccc3Cl)c3cc(O)ccc3C21 |
| InChI | InChI=1S/C19H20ClNO/c1-21-10-4-6-15-18(14-5-2-3-7-17(14)20)16-11-12(22)8-9-13(16)19(15)21/h2-3,5,7-9,11,15,18-19,22H,4,6,10H2,1H3 |
| InChIKey | UIHSSEDKRJSPCA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |