C17H19NO3 — CID 22768109
(5-methyl-1,3-dioxan-5-yl)-phenyl-pyridin-3-ylmethanol (PubChem CID 22768109) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (5-methyl-1,3-dioxan-5-yl)-phenyl-pyridin-3-ylmethanol.
| Compound Name | (5-methyl-1,3-dioxan-5-yl)-phenyl-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 22768109 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (5-methyl-1,3-dioxan-5-yl)-phenyl-pyridin-3-ylmethanol |
| SMILES | CC1(C(O)(c2ccccc2)c2cccnc2)COCOC1 |
| InChI | InChI=1S/C17H19NO3/c1-16(11-20-13-21-12-16)17(19,14-6-3-2-4-7-14)15-8-5-9-18-10-15/h2-10,19H,11-13H2,1H3 |
| InChIKey | SNVUFJNOQDGWOY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |