About N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide
N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide (PubChem CID 22768161) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide |
| PubChem CID | 22768161 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide |
| SMILES | CC(=O)Nc1cc(C(C)(C)C)on1 |
| InChI | InChI=1S/C9H14N2O2/c1-6(12)10-8-5-7(13-11-8)9(2,3)4/h5H,1-4H3,(H,10,11,12) |
| InChIKey | IVSPXHDALVJYAJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide?
The IUPAC name of N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide (CID 22768161) is N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide.
What is the SMILES notation for N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide?
The canonical SMILES for N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide is CC(=O)Nc1cc(C(C)(C)C)on1.
What is the InChIKey of N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide?
The InChIKey is IVSPXHDALVJYAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-6(12)10-8-5-7(13-11-8)9(2,3)4/h5H,1-4H3,(H,10,11,12).
What are the key properties of N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide?
N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide has a molecular weight of 182.22 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide is sourced from PubChem (CID 22768161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).