About 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane
2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane (PubChem CID 22768325) has the molecular formula C14H16O
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane.
Molecular Properties
| Compound Name | 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane |
| PubChem CID | 22768325 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane |
| SMILES | C=C/C=C/CCC1OC1c1ccccc1 |
| InChI | InChI=1S/C14H16O/c1-2-3-4-8-11-13-14(15-13)12-9-6-5-7-10-12/h2-7,9-10,13-14H,1,8,11H2/b4-3+ |
| InChIKey | BSJCJWSTBWKQER-ONEGZZNKSA-N |
| XLogP | 3.65 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane?
The IUPAC name of 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane (CID 22768325) is 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane.
What is the SMILES notation for 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane?
The canonical SMILES for 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane is C=C/C=C/CCC1OC1c1ccccc1.
What is the InChIKey of 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane?
The InChIKey is BSJCJWSTBWKQER-ONEGZZNKSA-N. The full InChI is InChI=1S/C14H16O/c1-2-3-4-8-11-13-14(15-13)12-9-6-5-7-10-12/h2-7,9-10,13-14H,1,8,11H2/b4-3+.
What are the key properties of 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane?
2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane has a molecular weight of 200.28 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3E)-hexa-3,5-dienyl]-3-phenyloxirane is sourced from PubChem (CID 22768325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).