C13H7F7N2S — CID 2276878
4,6-dimethyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylpyrimidine (PubChem CID 2276878) has the molecular formula C13H7F7N2S and a molecular weight of 356.27 g/mol. Its IUPAC name is 4,6-dimethyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylpyrimidine.
| Compound Name | 4,6-dimethyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylpyrimidine |
|---|---|
| PubChem CID | 2276878 |
| Molecular Formula | C13H7F7N2S |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 4,6-dimethyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylpyrimidine |
| SMILES | Cc1cc(C)nc(Sc2c(F)c(F)c(C(F)(F)F)c(F)c2F)n1 |
| InChI | InChI=1S/C13H7F7N2S/c1-4-3-5(2)22-12(21-4)23-11-9(16)7(14)6(13(18,19)20)8(15)10(11)17/h3H,1-2H3 |
| InChIKey | JLWPPMIJPFNOCZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|