C28H28F3NO4S — CID 22768868
N,N-diethyl-3-[4-[[2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-yl]sulfonyl]phenoxy]propan-1-amine (PubChem CID 22768868) has the molecular formula C28H28F3NO4S and a molecular weight of 531.60 g/mol. Its IUPAC name is N,N-diethyl-3-[4-[[2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-yl]sulfonyl]phenoxy]propan-1-amine.
| Compound Name | N,N-diethyl-3-[4-[[2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-yl]sulfonyl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 22768868 |
| Molecular Formula | C28H28F3NO4S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | N,N-diethyl-3-[4-[[2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-yl]sulfonyl]phenoxy]propan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc(S(=O)(=O)c2c(-c3ccc(C(F)(F)F)cc3)oc3ccccc23)cc1 |
| InChI | InChI=1S/C28H28F3NO4S/c1-3-32(4-2)18-7-19-35-22-14-16-23(17-15-22)37(33,34)27-24-8-5-6-9-25(24)36-26(27)20-10-12-21(13-11-20)28(29,30)31/h5-6,8-17H,3-4,7,18-19H2,1-2H3 |
| InChIKey | QCPNOUPBVDVKQB-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|