C16H14FNO2 — CID 22769043
2-(3-fluorophenyl)-5,6,7,8-tetrahydroquinoline-5-carboxylic acid (PubChem CID 22769043) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-5,6,7,8-tetrahydroquinoline-5-carboxylic acid.
| Compound Name | 2-(3-fluorophenyl)-5,6,7,8-tetrahydroquinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 22769043 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-(3-fluorophenyl)-5,6,7,8-tetrahydroquinoline-5-carboxylic acid |
| SMILES | O=C(O)C1CCCc2nc(-c3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C16H14FNO2/c17-11-4-1-3-10(9-11)14-8-7-12-13(16(19)20)5-2-6-15(12)18-14/h1,3-4,7-9,13H,2,5-6H2,(H,19,20) |
| InChIKey | XDOFFCYXLPMFAZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |