About [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate
[2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate (PubChem CID 22769191) has the molecular formula C17H12F3N3O2
and a molecular weight of 347.30 g/mol. Its IUPAC name is [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate.
Molecular Properties
| Compound Name | [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate |
| PubChem CID | 22769191 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate |
| SMILES | Cc1cc(OC(=O)c2ccc(F)cn2)n(Cc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C17H12F3N3O2/c1-10-6-16(25-17(24)15-5-3-12(18)8-21-15)23(22-10)9-11-2-4-13(19)14(20)7-11/h2-8H,9H2,1H3 |
| InChIKey | QSCJYUKXNQRPQM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate?
The IUPAC name of [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate (CID 22769191) is [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate.
What is the SMILES notation for [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate?
The canonical SMILES for [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate is Cc1cc(OC(=O)c2ccc(F)cn2)n(Cc2ccc(F)c(F)c2)n1.
What is the InChIKey of [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate?
The InChIKey is QSCJYUKXNQRPQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3N3O2/c1-10-6-16(25-17(24)15-5-3-12(18)8-21-15)23(22-10)9-11-2-4-13(19)14(20)7-11/h2-8H,9H2,1H3.
What are the key properties of [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate?
[2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate has a molecular weight of 347.30 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,4-difluorophenyl)methyl]-5-methylpyrazol-3-yl] 5-fluoropyridine-2-carboxylate is sourced from PubChem (CID 22769191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).