About [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate
[1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate (PubChem CID 22769254) has the molecular formula C24H15Cl2F3N2O3
and a molecular weight of 507.30 g/mol. Its IUPAC name is [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate.
Molecular Properties
| Compound Name | [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate |
| PubChem CID | 22769254 |
| Molecular Formula | C24H15Cl2F3N2O3 |
| Molecular Weight | 507.30 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate |
| SMILES | O=C(Oc1cc(-c2ccccc2)nn1Cc1ccc(Cl)c(Cl)c1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C24H15Cl2F3N2O3/c25-19-11-6-15(12-20(19)26)14-31-22(13-21(30-31)16-4-2-1-3-5-16)33-23(32)17-7-9-18(10-8-17)34-24(27,28)29/h1-13H,14H2 |
| InChIKey | OORBLLIEGTUBKB-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.30 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate?
The IUPAC name of [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate (CID 22769254) is [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate.
What is the SMILES notation for [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate?
The canonical SMILES for [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate is O=C(Oc1cc(-c2ccccc2)nn1Cc1ccc(Cl)c(Cl)c1)c1ccc(OC(F)(F)F)cc1.
What is the InChIKey of [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate?
The InChIKey is OORBLLIEGTUBKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15Cl2F3N2O3/c25-19-11-6-15(12-20(19)26)14-31-22(13-21(30-31)16-4-2-1-3-5-16)33-23(32)17-7-9-18(10-8-17)34-24(27,28)29/h1-13H,14H2.
What are the key properties of [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate?
[1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate has a molecular weight of 507.30 g/mol, XLogP of 7.02, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,4-dichlorophenyl)methyl]-3-phenylpyrazol-5-yl] 4-(trifluoromethoxy)benzoate is sourced from PubChem (CID 22769254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).