About [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate
[2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate (PubChem CID 22769261) has the molecular formula C15H11Cl2N3O3
and a molecular weight of 352.18 g/mol. Its IUPAC name is [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate.
Molecular Properties
| Compound Name | [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate |
| PubChem CID | 22769261 |
| Molecular Formula | C15H11Cl2N3O3 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate |
| SMILES | Cc1cc(OC(=O)c2ncco2)n(Cc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C15H11Cl2N3O3/c1-9-6-13(23-15(21)14-18-4-5-22-14)20(19-9)8-10-2-3-11(16)12(17)7-10/h2-7H,8H2,1H3 |
| InChIKey | YBLRRBVGEPLLED-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate?
The IUPAC name of [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate (CID 22769261) is [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate.
What is the SMILES notation for [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate?
The canonical SMILES for [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate is Cc1cc(OC(=O)c2ncco2)n(Cc2ccc(Cl)c(Cl)c2)n1.
What is the InChIKey of [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate?
The InChIKey is YBLRRBVGEPLLED-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2N3O3/c1-9-6-13(23-15(21)14-18-4-5-22-14)20(19-9)8-10-2-3-11(16)12(17)7-10/h2-7H,8H2,1H3.
What are the key properties of [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate?
[2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate has a molecular weight of 352.18 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl] 1,3-oxazole-2-carboxylate is sourced from PubChem (CID 22769261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).