C22H26N2O6-2 — CID 22769887
1,2-bis(4-isocyanatocyclohexyl)cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 22769887) has the molecular formula C22H26N2O6-2 and a molecular weight of 414.46 g/mol. Its IUPAC name is 1,2-bis(4-isocyanatocyclohexyl)cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | 1,2-bis(4-isocyanatocyclohexyl)cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 22769887 |
| Molecular Formula | C22H26N2O6-2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1,2-bis(4-isocyanatocyclohexyl)cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | O=C=NC1CCC(C2(C(=O)[O-])CC=CCC2(C(=O)[O-])C2CCC(N=C=O)CC2)CC1 |
| InChI | InChI=1S/C22H28N2O6/c25-13-23-17-7-3-15(4-8-17)21(19(27)28)11-1-2-12-22(21,20(29)30)16-5-9-18(10-6-16)24-14-26/h1-2,15-18H,3-12H2,(H,27,28)(H,29,30)/p-2 |
| InChIKey | LNCHRVCYLJFCOY-UHFFFAOYSA-L |
| XLogP | 0.60 |
| TPSA | 139.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|