About Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate
Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate (PubChem CID 22769947) has the molecular formula C16H16FNO3
and a molecular weight of 289.30 g/mol. Its IUPAC name is ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate.
Molecular Properties
| Compound Name | Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate |
| PubChem CID | 22769947 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N(C(=CC1=O)C)C2=CC=C(C=C2)F)C |
| InChI | InChI=1S/C16H16FNO3/c1-4-21-16(20)15-11(3)18(10(2)9-14(15)19)13-7-5-12(17)6-8-13/h5-9H,4H2,1-3H3 |
| InChIKey | YRWAKSJSZLHOTC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 502 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate?
The IUPAC name of Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate (CID 22769947) is ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate.
What is the SMILES notation for Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate?
The canonical SMILES for Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate is CCOC(=O)C1=C(N(C(=CC1=O)C)C2=CC=C(C=C2)F)C.
What is the InChIKey of Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate?
The InChIKey is YRWAKSJSZLHOTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FNO3/c1-4-21-16(20)15-11(3)18(10(2)9-14(15)19)13-7-5-12(17)6-8-13/h5-9H,4H2,1-3H3.
What are the key properties of Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate?
Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate has a molecular weight of 289.30 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 1-(4-fluorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxylate is sourced from PubChem (CID 22769947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).