About 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole
5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole (PubChem CID 22770057) has the molecular formula C12H13NS
and a molecular weight of 203.31 g/mol. Its IUPAC name is 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole |
| PubChem CID | 22770057 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole |
| SMILES | C#CCN1CSc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C12H13NS/c1-4-5-13-8-14-12-7-10(3)9(2)6-11(12)13/h1,6-7H,5,8H2,2-3H3 |
| InChIKey | GJGLQHQWSFSLBJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole?
The IUPAC name of 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole (CID 22770057) is 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole.
What is the SMILES notation for 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole?
The canonical SMILES for 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole is C#CCN1CSc2cc(C)c(C)cc21.
What is the InChIKey of 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole?
The InChIKey is GJGLQHQWSFSLBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NS/c1-4-5-13-8-14-12-7-10(3)9(2)6-11(12)13/h1,6-7H,5,8H2,2-3H3.
What are the key properties of 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole?
5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole has a molecular weight of 203.31 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-3-prop-2-ynyl-2H-1,3-benzothiazole is sourced from PubChem (CID 22770057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).