C11H18N2 — CID 22770284
2-phenylpentane-1,5-diamine (PubChem CID 22770284) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-phenylpentane-1,5-diamine.
| Compound Name | 2-phenylpentane-1,5-diamine |
|---|---|
| PubChem CID | 22770284 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-phenylpentane-1,5-diamine |
| SMILES | NCCCC(CN)c1ccccc1 |
| InChI | InChI=1S/C11H18N2/c12-8-4-7-11(9-13)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9,12-13H2 |
| InChIKey | ASLIRPJDOQNQLI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |