C15H14S2 — CID 22771
2,2-diphenyl-1,3-dithiolane (PubChem CID 22771) has the molecular formula C15H14S2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2,2-diphenyl-1,3-dithiolane.
| Compound Name | 2,2-diphenyl-1,3-dithiolane |
|---|---|
| PubChem CID | 22771 |
| Molecular Formula | C15H14S2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2,2-diphenyl-1,3-dithiolane |
| SMILES | c1ccc(C2(c3ccccc3)SCCS2)cc1 |
| InChI | InChI=1S/C15H14S2/c1-3-7-13(8-4-1)15(16-11-12-17-15)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | NPCVWOFQCBKKNO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |