C13H27N3O — CID 2277117
1-propyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 2277117) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-propyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1-propyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 2277117 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 1-propyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CCCNC(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C13H27N3O/c1-6-7-14-11(17)15-10-8-12(2,3)16-13(4,5)9-10/h10,16H,6-9H2,1-5H3,(H2,14,15,17) |
| InChIKey | VSLQMNDAUNPNTD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |