C16H16N4O2S — CID 22771721
N-[1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]benzenesulfonamide (PubChem CID 22771721) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is N-[1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]benzenesulfonamide.
| Compound Name | N-[1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22771721 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]benzenesulfonamide |
| SMILES | Cc1cccc(Cn2cnc(NS(=O)(=O)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C16H16N4O2S/c1-13-6-5-7-14(10-13)11-20-12-17-16(18-20)19-23(21,22)15-8-3-2-4-9-15/h2-10,12H,11H2,1H3,(H,18,19) |
| InChIKey | FQESXAONFIGVNU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |