C20H23ClN4O2S — CID 22771837
N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 22771837) has the molecular formula C20H23ClN4O2S and a molecular weight of 418.95 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22771837 |
| Molecular Formula | C20H23ClN4O2S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)Nc2ncn(Cc3ccc(Cl)cc3)n2)c(C)c1C |
| InChI | InChI=1S/C20H23ClN4O2S/c1-12-13(2)15(4)19(16(5)14(12)3)28(26,27)24-20-22-11-25(23-20)10-17-6-8-18(21)9-7-17/h6-9,11H,10H2,1-5H3,(H,23,24) |
| InChIKey | MQVFXRQCNPPPHI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |