C14H21ClN2O2S — CID 22772557
4-chloro-2,5-dimethyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide (PubChem CID 22772557) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is 4-chloro-2,5-dimethyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 4-chloro-2,5-dimethyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22772557 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-chloro-2,5-dimethyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCN(C)CC2)c(C)cc1Cl |
| InChI | InChI=1S/C14H21ClN2O2S/c1-10-9-14(11(2)8-13(10)15)20(18,19)16-12-4-6-17(3)7-5-12/h8-9,12,16H,4-7H2,1-3H3 |
| InChIKey | DWZJPFSRIPFNOG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |