About (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one
(3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one (PubChem CID 2277306) has the molecular formula C17H10Cl2O2
and a molecular weight of 317.17 g/mol. Its IUPAC name is (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one.
Molecular Properties
| Compound Name | (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one |
| PubChem CID | 2277306 |
| Molecular Formula | C17H10Cl2O2 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one |
| SMILES | O=C1OC(c2ccccc2)=C/C1=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H10Cl2O2/c18-14-7-4-8-15(19)13(14)9-12-10-16(21-17(12)20)11-5-2-1-3-6-11/h1-10H/b12-9+ |
| InChIKey | OQPDGQFYGCQKQL-FMIVXFBMSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one?
The IUPAC name of (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one (CID 2277306) is (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one.
What is the SMILES notation for (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one?
The canonical SMILES for (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one is O=C1OC(c2ccccc2)=C/C1=C\c1c(Cl)cccc1Cl.
What is the InChIKey of (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one?
The InChIKey is OQPDGQFYGCQKQL-FMIVXFBMSA-N. The full InChI is InChI=1S/C17H10Cl2O2/c18-14-7-4-8-15(19)13(14)9-12-10-16(21-17(12)20)11-5-2-1-3-6-11/h1-10H/b12-9+.
What are the key properties of (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one?
(3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one has a molecular weight of 317.17 g/mol, XLogP of 4.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(2,6-dichlorophenyl)methylidene]-5-phenylfuran-2-one is sourced from PubChem (CID 2277306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).