C21H11F5O3 — CID 2277386
4-methyl-3-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzo[c]chromen-6-one (PubChem CID 2277386) has the molecular formula C21H11F5O3 and a molecular weight of 406.31 g/mol. Its IUPAC name is 4-methyl-3-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzo[c]chromen-6-one.
| Compound Name | 4-methyl-3-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 2277386 |
| Molecular Formula | C21H11F5O3 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 4-methyl-3-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzo[c]chromen-6-one |
| SMILES | Cc1c(OCc2c(F)c(F)c(F)c(F)c2F)ccc2c1oc(=O)c1ccccc12 |
| InChI | InChI=1S/C21H11F5O3/c1-9-14(28-8-13-15(22)17(24)19(26)18(25)16(13)23)7-6-11-10-4-2-3-5-12(10)21(27)29-20(9)11/h2-7H,8H2,1H3 |
| InChIKey | USQWCXQCHJTMGO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|