C16H18ClNO3S — CID 22774232
4-chloro-N-(2-ethoxyphenyl)-2,5-dimethylbenzenesulfonamide (PubChem CID 22774232) has the molecular formula C16H18ClNO3S and a molecular weight of 339.84 g/mol. Its IUPAC name is 4-chloro-N-(2-ethoxyphenyl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(2-ethoxyphenyl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22774232 |
| Molecular Formula | C16H18ClNO3S |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 4-chloro-N-(2-ethoxyphenyl)-2,5-dimethylbenzenesulfonamide |
| SMILES | CCOc1ccccc1NS(=O)(=O)c1cc(C)c(Cl)cc1C |
| InChI | InChI=1S/C16H18ClNO3S/c1-4-21-15-8-6-5-7-14(15)18-22(19,20)16-10-11(2)13(17)9-12(16)3/h5-10,18H,4H2,1-3H3 |
| InChIKey | AHVLROALYGHVSM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |