C19H15N2O8- — CID 2277435
2-[4-[(Z)-[1-(furan-2-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 2277435) has the molecular formula C19H15N2O8- and a molecular weight of 399.34 g/mol. Its IUPAC name is 2-[4-[(Z)-[1-(furan-2-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | 2-[4-[(Z)-[1-(furan-2-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 2277435 |
| Molecular Formula | C19H15N2O8- |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2-[4-[(Z)-[1-(furan-2-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | COc1cc(/C=C2/C(=O)NC(=O)N(Cc3ccco3)C2=O)ccc1OCC(=O)[O-] |
| InChI | InChI=1S/C19H16N2O8/c1-27-15-8-11(4-5-14(15)29-10-16(22)23)7-13-17(24)20-19(26)21(18(13)25)9-12-3-2-6-28-12/h2-8H,9-10H2,1H3,(H,22,23)(H,20,24,26)/p-1/b13-7- |
| InChIKey | WIJIZQOTOUBYQI-QPEQYQDCSA-M |
| XLogP | 0.08 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|