C15H16N2O4S — CID 22775051
3,4-dimethyl-N-(4-methyl-3-nitrophenyl)benzenesulfonamide (PubChem CID 22775051) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 3,4-dimethyl-N-(4-methyl-3-nitrophenyl)benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-(4-methyl-3-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22775051 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3,4-dimethyl-N-(4-methyl-3-nitrophenyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C)c([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C15H16N2O4S/c1-10-5-7-14(8-12(10)3)22(20,21)16-13-6-4-11(2)15(9-13)17(18)19/h4-9,16H,1-3H3 |
| InChIKey | VLCQQYNQSUVMQN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|