C20H21N3O4S — CID 22775153
ethyl 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfonylamino]benzoate (PubChem CID 22775153) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is ethyl 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfonylamino]benzoate.
| Compound Name | ethyl 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 22775153 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | ethyl 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NS(=O)(=O)c1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C20H21N3O4S/c1-4-27-20(24)17-12-8-9-13-18(17)22-28(25,26)19-14(2)21-23(15(19)3)16-10-6-5-7-11-16/h5-13,22H,4H2,1-3H3 |
| InChIKey | KWHAQSCTAYNSLA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |