C24H24N2O4S — CID 22780504
N-[4-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide (PubChem CID 22780504) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[4-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide.
| Compound Name | N-[4-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 22780504 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[4-[2-(3,5-dimethoxyanilino)-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide |
| SMILES | COc1cc(NC(=O)CSc2ccc(NC(=O)c3ccccc3C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C24H24N2O4S/c1-16-6-4-5-7-22(16)24(28)26-17-8-10-21(11-9-17)31-15-23(27)25-18-12-19(29-2)14-20(13-18)30-3/h4-14H,15H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | DWBLEFSIHJTSRA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |