C22H21FN2O3S2 — CID 22781714
N-(4-fluorophenyl)-2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpropanamide (PubChem CID 22781714) has the molecular formula C22H21FN2O3S2 and a molecular weight of 444.55 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpropanamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 22781714 |
| Molecular Formula | C22H21FN2O3S2 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(SC(C)C(=O)Nc3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H21FN2O3S2/c1-15-3-13-21(14-4-15)30(27,28)25-19-9-11-20(12-10-19)29-16(2)22(26)24-18-7-5-17(23)6-8-18/h3-14,16,25H,1-2H3,(H,24,26) |
| InChIKey | FPANXKHZWBSPBA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |