About 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide
5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide (PubChem CID 22782067) has the molecular formula C9H11I2N3S
and a molecular weight of 447.08 g/mol. Its IUPAC name is 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide.
Molecular Properties
| Compound Name | 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide |
| PubChem CID | 22782067 |
| Molecular Formula | C9H11I2N3S |
| Molecular Weight | 447.08 g/mol |
| Exact Mass | 446.88 |
| IUPAC Name | 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide |
| SMILES | I.ICC1CN=C(Nc2ccccn2)S1 |
| InChI | InChI=1S/C9H10IN3S.HI/c10-5-7-6-12-9(14-7)13-8-3-1-2-4-11-8;/h1-4,7H,5-6H2,(H,11,12,13);1H |
| InChIKey | BBEHLCAYPLLIOZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.08 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide?
The IUPAC name of 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide (CID 22782067) is 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide.
What is the SMILES notation for 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide?
The canonical SMILES for 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide is I.ICC1CN=C(Nc2ccccn2)S1.
What is the InChIKey of 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide?
The InChIKey is BBEHLCAYPLLIOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10IN3S.HI/c10-5-7-6-12-9(14-7)13-8-3-1-2-4-11-8;/h1-4,7H,5-6H2,(H,11,12,13);1H.
What are the key properties of 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide?
5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide has a molecular weight of 447.08 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(iodomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide is sourced from PubChem (CID 22782067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).