C26H21ClN2O2 — CID 2278590
(6R,6aS)-2-benzoyl-6-(3-chlorophenyl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 2278590) has the molecular formula C26H21ClN2O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is (6R,6aS)-2-benzoyl-6-(3-chlorophenyl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,6aS)-2-benzoyl-6-(3-chlorophenyl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 2278590 |
| Molecular Formula | C26H21ClN2O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (6R,6aS)-2-benzoyl-6-(3-chlorophenyl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C(c1ccccc1)c1ccc2c(c1)NC1=CCCC(=O)[C@H]1[C@H](c1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C26H21ClN2O2/c27-19-9-4-8-17(14-19)25-24-21(10-5-11-23(24)30)28-22-15-18(12-13-20(22)29-25)26(31)16-6-2-1-3-7-16/h1-4,6-10,12-15,24-25,28-29H,5,11H2/t24-,25-/m0/s1 |
| InChIKey | PIJZPKHBBGDPTR-DQEYMECFSA-N |
| XLogP | 6.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |