C20H13FN4O4S — CID 22786738
3-[[5-(1,3-benzodioxol-5-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 22786738) has the molecular formula C20H13FN4O4S and a molecular weight of 424.41 g/mol. Its IUPAC name is 3-[[5-(1,3-benzodioxol-5-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[[5-(1,3-benzodioxol-5-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 22786738 |
| Molecular Formula | C20H13FN4O4S |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 3-[[5-(1,3-benzodioxol-5-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Sc2nncc(-c3ccc4c(c3)OCO4)n2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H13FN4O4S/c21-12-2-4-13(5-3-12)25-18(26)8-17(19(25)27)30-20-23-14(9-22-24-20)11-1-6-15-16(7-11)29-10-28-15/h1-7,9,17H,8,10H2 |
| InChIKey | MFIFMYMBHHXWOE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|