C31H21Cl2FN2O3 — CID 22786896
N-[(Z)-3-[4-[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]anilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22786896) has the molecular formula C31H21Cl2FN2O3 and a molecular weight of 559.42 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]anilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]anilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22786896 |
| Molecular Formula | C31H21Cl2FN2O3 |
| Molecular Weight | 559.42 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | N-[(Z)-3-[4-[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]anilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)/C=C/c2c(F)cccc2Cl)cc1)/C(=C/c1ccccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H21Cl2FN2O3/c32-25-10-5-4-9-22(25)19-28(36-30(38)21-7-2-1-3-8-21)31(39)35-23-15-13-20(14-16-23)29(37)18-17-24-26(33)11-6-12-27(24)34/h1-19H,(H,35,39)(H,36,38)/b18-17+,28-19- |
| InChIKey | CKOSNZUJOFBQCC-FYWJNZCMSA-N |
| XLogP | 7.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.42 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|