C21H23N7O5 — CID 22787948
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate (PubChem CID 22787948) has the molecular formula C21H23N7O5 and a molecular weight of 453.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 22787948 |
| Molecular Formula | C21H23N7O5 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)[C@@H](N)Cc2c[nH]c3ccccc23)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H23N7O5/c22-12(5-10-6-24-13-4-2-1-3-11(10)13)21(31)32-7-14-16(29)17(30)20(33-14)28-9-27-15-18(23)25-8-26-19(15)28/h1-4,6,8-9,12,14,16-17,20,24,29-30H,5,7,22H2,(H2,23,25,26)/t12-,14+,16+,17+,20+/m0/s1 |
| InChIKey | XLPJXHCJOUBUMF-SQIXAUHQSA-N |
| XLogP | -0.38 |
| TPSA | 187.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |