C22H40N2 — CID 22787995
(5E,9E)-3,12-dihexyl-1,2-diazacyclododeca-1,5,9-triene (PubChem CID 22787995) has the molecular formula C22H40N2 and a molecular weight of 332.58 g/mol. Its IUPAC name is (5E,9E)-3,12-dihexyl-1,2-diazacyclododeca-1,5,9-triene.
| Compound Name | (5E,9E)-3,12-dihexyl-1,2-diazacyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 22787995 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | (5E,9E)-3,12-dihexyl-1,2-diazacyclododeca-1,5,9-triene |
| SMILES | CCCCCCC1C/C=C/CC/C=C/CC(CCCCCC)/N=N/1 |
| InChI | InChI=1S/C22H40N2/c1-3-5-7-13-17-21-19-15-11-9-10-12-16-20-22(24-23-21)18-14-8-6-4-2/h11-12,15-16,21-22H,3-10,13-14,17-20H2,1-2H3/b15-11+,16-12+,24-23+ |
| InChIKey | MKMSIIZNKGNYNZ-ITODLCQWSA-N |
| XLogP | 7.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|