About benzo[g][1,3]benzoselenazole
benzo[g][1,3]benzoselenazole (PubChem CID 22788307) has the molecular formula C11H7NSe
and a molecular weight of 232.14 g/mol. Its IUPAC name is benzo[g][1,3]benzoselenazole.
Molecular Properties
| Compound Name | benzo[g][1,3]benzoselenazole |
| PubChem CID | 22788307 |
| Molecular Formula | C11H7NSe |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 232.97 |
| IUPAC Name | benzo[g][1,3]benzoselenazole |
| SMILES | c1ccc2c(c1)ccc1nc[se]c12 |
| InChI | InChI=1S/C11H7NSe/c1-2-4-9-8(3-1)5-6-10-11(9)13-7-12-10/h1-7H |
| InChIKey | IEICFDLIJMHYQB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzo[g][1,3]benzoselenazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[g][1,3]benzoselenazole?
The IUPAC name of benzo[g][1,3]benzoselenazole (CID 22788307) is benzo[g][1,3]benzoselenazole.
What is the SMILES notation for benzo[g][1,3]benzoselenazole?
The canonical SMILES for benzo[g][1,3]benzoselenazole is c1ccc2c(c1)ccc1nc[se]c12.
What is the InChIKey of benzo[g][1,3]benzoselenazole?
The InChIKey is IEICFDLIJMHYQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NSe/c1-2-4-9-8(3-1)5-6-10-11(9)13-7-12-10/h1-7H.
What are the key properties of benzo[g][1,3]benzoselenazole?
benzo[g][1,3]benzoselenazole has a molecular weight of 232.14 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[g][1,3]benzoselenazole is sourced from PubChem (CID 22788307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).