C27H30N4O2 — CID 22788409
[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl N-[2-(1H-indol-3-yl)ethyl]carbamate (PubChem CID 22788409) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is [(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl N-[2-(1H-indol-3-yl)ethyl]carbamate.
| Compound Name | [(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl N-[2-(1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 22788409 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | [(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl N-[2-(1H-indol-3-yl)ethyl]carbamate |
| SMILES | CN1C[C@H](COC(=O)NCCc2c[nH]c3ccccc23)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C27H30N4O2/c1-31-15-17(11-22-21-6-4-8-24-26(21)19(14-30-24)12-25(22)31)16-33-27(32)28-10-9-18-13-29-23-7-3-2-5-20(18)23/h2-8,13-14,17,22,25,29-30H,9-12,15-16H2,1H3,(H,28,32)/t17-,22?,25-/m1/s1 |
| InChIKey | QRMXDMPTQGIGBA-FOBFEARMSA-N |
| XLogP | 4.58 |
| TPSA | 73.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |