C11H16O2S2 — CID 22788695
(1R,5S)-4-(1,3-dithian-2-yl)-5-methylcyclopent-2-ene-1-carboxylic acid (PubChem CID 22788695) has the molecular formula C11H16O2S2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (1R,5S)-4-(1,3-dithian-2-yl)-5-methylcyclopent-2-ene-1-carboxylic acid.
| Compound Name | (1R,5S)-4-(1,3-dithian-2-yl)-5-methylcyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22788695 |
| Molecular Formula | C11H16O2S2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | (1R,5S)-4-(1,3-dithian-2-yl)-5-methylcyclopent-2-ene-1-carboxylic acid |
| SMILES | C[C@@H]1C(C2SCCCS2)C=C[C@H]1C(=O)O |
| InChI | InChI=1S/C11H16O2S2/c1-7-8(10(12)13)3-4-9(7)11-14-5-2-6-15-11/h3-4,7-9,11H,2,5-6H2,1H3,(H,12,13)/t7-,8+,9?/m0/s1 |
| InChIKey | DHXYIQXHKZLOBQ-ZQTLJVIJSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|