C10H14O2S2 — CID 22788697
(1R,5S)-4-(1,3-dithiolan-2-yl)-5-methylcyclopent-2-ene-1-carboxylic acid (PubChem CID 22788697) has the molecular formula C10H14O2S2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (1R,5S)-4-(1,3-dithiolan-2-yl)-5-methylcyclopent-2-ene-1-carboxylic acid.
| Compound Name | (1R,5S)-4-(1,3-dithiolan-2-yl)-5-methylcyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22788697 |
| Molecular Formula | C10H14O2S2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | (1R,5S)-4-(1,3-dithiolan-2-yl)-5-methylcyclopent-2-ene-1-carboxylic acid |
| SMILES | C[C@@H]1C(C2SCCS2)C=C[C@H]1C(=O)O |
| InChI | InChI=1S/C10H14O2S2/c1-6-7(9(11)12)2-3-8(6)10-13-4-5-14-10/h2-3,6-8,10H,4-5H2,1H3,(H,11,12)/t6-,7+,8?/m0/s1 |
| InChIKey | VFZKSNAGMQNGRR-KJFJCRTCSA-N |
| XLogP | 2.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|