About methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate
methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate (PubChem CID 22788700) has the molecular formula C11H16O2S2
and a molecular weight of 244.38 g/mol. Its IUPAC name is methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate |
| PubChem CID | 22788700 |
| Molecular Formula | C11H16O2S2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC=C[C@@H]1C1SCCCS1 |
| InChI | InChI=1S/C11H16O2S2/c1-13-10(12)8-4-2-5-9(8)11-14-6-3-7-15-11/h2,5,8-9,11H,3-4,6-7H2,1H3/t8-,9-/m0/s1 |
| InChIKey | WFUXXJAIJCCZPN-IUCAKERBSA-N |
| XLogP | 2.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate?
The IUPAC name of methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate (CID 22788700) is methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate.
What is the SMILES notation for methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate?
The canonical SMILES for methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate is COC(=O)[C@H]1CC=C[C@@H]1C1SCCCS1.
What is the InChIKey of methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate?
The InChIKey is WFUXXJAIJCCZPN-IUCAKERBSA-N. The full InChI is InChI=1S/C11H16O2S2/c1-13-10(12)8-4-2-5-9(8)11-14-6-3-7-15-11/h2,5,8-9,11H,3-4,6-7H2,1H3/t8-,9-/m0/s1.
What are the key properties of methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate?
methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate has a molecular weight of 244.38 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1S,2S)-2-(1,3-dithian-2-yl)cyclopent-3-ene-1-carboxylate is sourced from PubChem (CID 22788700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).