C17H17ClN4O5S — CID 22790789
(6S)-7-[[2-[(1-amino-2-phenoxyethylidene)amino]acetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22790789) has the molecular formula C17H17ClN4O5S and a molecular weight of 424.87 g/mol. Its IUPAC name is (6S)-7-[[2-[(1-amino-2-phenoxyethylidene)amino]acetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-[(1-amino-2-phenoxyethylidene)amino]acetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22790789 |
| Molecular Formula | C17H17ClN4O5S |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | (6S)-7-[[2-[(1-amino-2-phenoxyethylidene)amino]acetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | N/C(COc1ccccc1)=N\CC(=O)NC1C(=O)N2C(C(=O)O)=C(Cl)CS[C@@H]12 |
| InChI | InChI=1S/C17H17ClN4O5S/c18-10-8-28-16-13(15(24)22(16)14(10)17(25)26)21-12(23)6-20-11(19)7-27-9-4-2-1-3-5-9/h1-5,13,16H,6-8H2,(H2,19,20)(H,21,23)(H,25,26)/t13?,16-/m0/s1 |
| InChIKey | WLBDOBAMCMCCJM-VYIIXAMBSA-N |
| XLogP | 0.36 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|