C24H38O4 — CID 22791078
(1S,3aS,7aS)-4-[2-(3,4-dimethoxyphenyl)ethyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,4,5,6,7-octahydroinden-5-ol (PubChem CID 22791078) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is (1S,3aS,7aS)-4-[2-(3,4-dimethoxyphenyl)ethyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,4,5,6,7-octahydroinden-5-ol.
| Compound Name | (1S,3aS,7aS)-4-[2-(3,4-dimethoxyphenyl)ethyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,4,5,6,7-octahydroinden-5-ol |
|---|---|
| PubChem CID | 22791078 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (1S,3aS,7aS)-4-[2-(3,4-dimethoxyphenyl)ethyl]-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,4,5,6,7-octahydroinden-5-ol |
| SMILES | COc1ccc(CCC2C(O)CC[C@]3(C)[C@@H](OC(C)(C)C)CC[C@@H]23)cc1OC |
| InChI | InChI=1S/C24H38O4/c1-23(2,3)28-22-12-10-18-17(19(25)13-14-24(18,22)4)9-7-16-8-11-20(26-5)21(15-16)27-6/h8,11,15,17-19,22,25H,7,9-10,12-14H2,1-6H3/t17?,18-,19?,22-,24-/m0/s1 |
| InChIKey | VXZBMFUZIUKENB-WQXYNRKZSA-N |
| XLogP | 5.01 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |