C27H42O4S — CID 22791737
7-[(1R,2R,5R)-2-hydroxy-5-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoic acid (PubChem CID 22791737) has the molecular formula C27H42O4S and a molecular weight of 462.70 g/mol. Its IUPAC name is 7-[(1R,2R,5R)-2-hydroxy-5-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5R)-2-hydroxy-5-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22791737 |
| Molecular Formula | C27H42O4S |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 7-[(1R,2R,5R)-2-hydroxy-5-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoic acid |
| SMILES | Cc1ccc(S(=O)CCCCC/C=C/C[C@H]2CC[C@@H](O)[C@@H]2CCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C27H42O4S/c1-22-15-18-24(19-16-22)32(31)21-11-7-3-2-4-8-12-23-17-20-26(28)25(23)13-9-5-6-10-14-27(29)30/h4,8,15-16,18-19,23,25-26,28H,2-3,5-7,9-14,17,20-21H2,1H3,(H,29,30)/b8-4+/t23-,25+,26+,32?/m0/s1 |
| InChIKey | PHBHMFLNYNRFKC-SVOYINIBSA-N |
| XLogP | 6.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|