C27H42O5S — CID 22791739
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoic acid (PubChem CID 22791739) has the molecular formula C27H42O5S and a molecular weight of 478.70 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22791739 |
| Molecular Formula | C27H42O5S |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoic acid |
| SMILES | Cc1ccc(S(=O)CCCCC/C=C/C[C@@H]2[C@@H](CCCCCCC(=O)O)[C@@H](O)C[C@H]2O)cc1 |
| InChI | InChI=1S/C27H42O5S/c1-21-15-17-22(18-16-21)33(32)19-11-7-3-2-4-8-12-23-24(26(29)20-25(23)28)13-9-5-6-10-14-27(30)31/h4,8,15-18,23-26,28-29H,2-3,5-7,9-14,19-20H2,1H3,(H,30,31)/b8-4+/t23-,24-,25-,26+,33?/m1/s1 |
| InChIKey | YYESSROIRINURJ-ZKOXLWQOSA-N |
| XLogP | 5.39 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|