C30H48O5SSi — CID 22791745
2-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]ethyl acetate (PubChem CID 22791745) has the molecular formula C30H48O5SSi and a molecular weight of 548.86 g/mol. Its IUPAC name is 2-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]ethyl acetate.
| Compound Name | 2-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]ethyl acetate |
|---|---|
| PubChem CID | 22791745 |
| Molecular Formula | C30H48O5SSi |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | 2-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]ethyl acetate |
| SMILES | CC(=O)OCC[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C/CCCCCS(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H48O5SSi/c1-23-15-17-25(18-16-23)36(33)21-13-11-9-8-10-12-14-27-26(19-20-34-24(2)31)28(32)22-29(27)35-37(6,7)30(3,4)5/h10,12,15-18,26-27,29H,8-9,11,13-14,19-22H2,1-7H3/b12-10+/t26-,27-,29-,36?/m1/s1 |
| InChIKey | GVXRRDVQFKGIIZ-IJJSTKHYSA-N |
| XLogP | 7.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|