C34H56O5SSi — CID 22791755
methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 22791755) has the molecular formula C34H56O5SSi and a molecular weight of 604.97 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22791755 |
| Molecular Formula | C34H56O5SSi |
| Molecular Weight | 604.97 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C/CCCCCS(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H56O5SSi/c1-27-21-23-28(24-22-27)40(37)25-17-13-9-8-10-15-19-30-29(18-14-11-12-16-20-33(36)38-5)31(35)26-32(30)39-41(6,7)34(2,3)4/h10,15,21-24,29-30,32H,8-9,11-14,16-20,25-26H2,1-7H3/b15-10+/t29-,30-,32-,40?/m1/s1 |
| InChIKey | XSITVJVYUAXIHE-LMDGJIDRSA-N |
| XLogP | 8.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.97 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|