C28H42O5S — CID 22791756
methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 22791756) has the molecular formula C28H42O5S and a molecular weight of 490.71 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22791756 |
| Molecular Formula | C28H42O5S |
| Molecular Weight | 490.71 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1C/C=C/CCCCCS(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H42O5S/c1-22-16-18-23(19-17-22)34(32)20-12-8-4-3-5-9-13-24-25(27(30)21-26(24)29)14-10-6-7-11-15-28(31)33-2/h5,9,16-19,24-26,29H,3-4,6-8,10-15,20-21H2,1-2H3/b9-5+/t24-,25-,26-,34?/m1/s1 |
| InChIKey | GBCYOIIADIAIFA-JZLJKULUSA-N |
| XLogP | 5.69 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|