C28H44O4S — CID 22792214
methyl 7-[(1R,2S,5R)-2-hydroxy-5-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoate (PubChem CID 22792214) has the molecular formula C28H44O4S and a molecular weight of 476.72 g/mol. Its IUPAC name is methyl 7-[(1R,2S,5R)-2-hydroxy-5-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S,5R)-2-hydroxy-5-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22792214 |
| Molecular Formula | C28H44O4S |
| Molecular Weight | 476.72 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | methyl 7-[(1R,2S,5R)-2-hydroxy-5-[(E)-8-(4-methylphenyl)sulfinyloct-2-enyl]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](C/C=C/CCCCCS(=O)c2ccc(C)cc2)CC[C@@H]1O |
| InChI | InChI=1S/C28H44O4S/c1-23-16-19-25(20-17-23)33(31)22-12-8-4-3-5-9-13-24-18-21-27(29)26(24)14-10-6-7-11-15-28(30)32-2/h5,9,16-17,19-20,24,26-27,29H,3-4,6-8,10-15,18,21-22H2,1-2H3/b9-5+/t24-,26+,27-,33?/m0/s1 |
| InChIKey | VJMBTFHUKZJTTK-OFYXHWNMSA-N |
| XLogP | 6.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.72 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|